C12H24N4O2 — CID 154146369
1,3-bis(3-aminopropyl)-5,5-dimethyl-1,3-diazinane-2,4-dione (PubChem CID 154146369) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1,3-bis(3-aminopropyl)-5,5-dimethyl-1,3-diazinane-2,4-dione.
| Compound Name | 1,3-bis(3-aminopropyl)-5,5-dimethyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 154146369 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1,3-bis(3-aminopropyl)-5,5-dimethyl-1,3-diazinane-2,4-dione |
| SMILES | CC1(C)CN(CCCN)C(=O)N(CCCN)C1=O |
| InChI | InChI=1S/C12H24N4O2/c1-12(2)9-15(7-3-5-13)11(18)16(10(12)17)8-4-6-14/h3-9,13-14H2,1-2H3 |
| InChIKey | LQSNEYBHACKMDP-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |