C11H19N3O2 — CID 18071372
3-(3-aminopropyl)-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 18071372) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(3-aminopropyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18071372 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-(3-aminopropyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | NCCCN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C11H19N3O2/c12-7-4-8-14-9(15)11(13-10(14)16)5-2-1-3-6-11/h1-8,12H2,(H,13,16) |
| InChIKey | OXYGSILBZGKBBL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|