C15H25N3O2S — CID 65259999
5-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2,2-dimethylpentanethioamide (PubChem CID 65259999) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 5-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2,2-dimethylpentanethioamide.
| Compound Name | 5-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2,2-dimethylpentanethioamide |
|---|---|
| PubChem CID | 65259999 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 5-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2,2-dimethylpentanethioamide |
| SMILES | CC(C)(CCCN1C(=O)NC2(CCCCC2)C1=O)C(N)=S |
| InChI | InChI=1S/C15H25N3O2S/c1-14(2,11(16)21)7-6-10-18-12(19)15(17-13(18)20)8-4-3-5-9-15/h3-10H2,1-2H3,(H2,16,21)(H,17,20) |
| InChIKey | HKAJNOVMTYCBSQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|