C16H25N3O2 — CID 65251834
4-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2,2-dimethylbutanenitrile (PubChem CID 65251834) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65251834 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCN1C(=O)NC2(CCCCCCC2)C1=O |
| InChI | InChI=1S/C16H25N3O2/c1-15(2,12-17)10-11-19-13(20)16(18-14(19)21)8-6-4-3-5-7-9-16/h3-11H2,1-2H3,(H,18,21) |
| InChIKey | XOMGZAGPHDUFOG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|