C7H14ClN3O2 — CID 14008501
3-(2-aminoethyl)-5,5-dimethylimidazolidine-2,4-dione;hydrochloride (PubChem CID 14008501) has the molecular formula C7H14ClN3O2 and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-(2-aminoethyl)-5,5-dimethylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-(2-aminoethyl)-5,5-dimethylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 14008501 |
| Molecular Formula | C7H14ClN3O2 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-(2-aminoethyl)-5,5-dimethylimidazolidine-2,4-dione;hydrochloride |
| SMILES | CC1(C)NC(=O)N(CCN)C1=O.Cl |
| InChI | InChI=1S/C7H13N3O2.ClH/c1-7(2)5(11)10(4-3-8)6(12)9-7;/h3-4,8H2,1-2H3,(H,9,12);1H |
| InChIKey | YVISQQCJVDUFNZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|