About 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione
3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 12847944) has the molecular formula C6H9BrN2O2
and a molecular weight of 221.05 g/mol. Its IUPAC name is 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione |
| PubChem CID | 12847944 |
| Molecular Formula | C6H9BrN2O2 |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CBr)C1=O |
| InChI | InChI=1S/C6H9BrN2O2/c1-6(2)4(10)9(3-7)5(11)8-6/h3H2,1-2H3,(H,8,11) |
| InChIKey | ZQODMSOYMHYRBQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione?
The IUPAC name of 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione (CID 12847944) is 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione.
What is the SMILES notation for 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione?
The canonical SMILES for 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione is CC1(C)NC(=O)N(CBr)C1=O.
What is the InChIKey of 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione?
The InChIKey is ZQODMSOYMHYRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2O2/c1-6(2)4(10)9(3-7)5(11)8-6/h3H2,1-2H3,(H,8,11).
What are the key properties of 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione?
3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione has a molecular weight of 221.05 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione is sourced from PubChem (CID 12847944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).