C6H9BrN2O2 — CID 12847944
3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 12847944) has the molecular formula C6H9BrN2O2 and a molecular weight of 221.05 g/mol. Its IUPAC name is 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 12847944 |
| Molecular Formula | C6H9BrN2O2 |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 3-(bromomethyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CBr)C1=O |
| InChI | InChI=1S/C6H9BrN2O2/c1-6(2)4(10)9(3-7)5(11)8-6/h3H2,1-2H3,(H,8,11) |
| InChIKey | ZQODMSOYMHYRBQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|