C10H15ClN2O3 — CID 21493759
3-(5-chloro-3-oxopentyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 21493759) has the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. Its IUPAC name is 3-(5-chloro-3-oxopentyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(5-chloro-3-oxopentyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21493759 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-(5-chloro-3-oxopentyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCC(=O)CCCl)C1=O |
| InChI | InChI=1S/C10H15ClN2O3/c1-10(2)8(15)13(9(16)12-10)6-4-7(14)3-5-11/h3-6H2,1-2H3,(H,12,16) |
| InChIKey | TVMNZAYVDIESRV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|