C11H16Cl2N2O2 — CID 2332981
3-[[(1S)-2,2-dichloro-3,3-dimethylcyclopropyl]methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 2332981) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is 3-[[(1S)-2,2-dichloro-3,3-dimethylcyclopropyl]methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[(1S)-2,2-dichloro-3,3-dimethylcyclopropyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2332981 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-[[(1S)-2,2-dichloro-3,3-dimethylcyclopropyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(C[C@@H]2C(C)(C)C2(Cl)Cl)C1=O |
| InChI | InChI=1S/C11H16Cl2N2O2/c1-9(2)6(11(9,12)13)5-15-7(16)10(3,4)14-8(15)17/h6H,5H2,1-4H3,(H,14,17)/t6-/m1/s1 |
| InChIKey | FYBOFCDFELTKAI-ZCFIWIBFSA-N |
| XLogP | 2.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|