C12H15N3O2 — CID 5200341
3-[(4-aminophenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 5200341) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-aminophenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5200341 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-[(4-aminophenyl)methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(Cc2ccc(N)cc2)C1=O |
| InChI | InChI=1S/C12H15N3O2/c1-12(2)10(16)15(11(17)14-12)7-8-3-5-9(13)6-4-8/h3-6H,7,13H2,1-2H3,(H,14,17) |
| InChIKey | WLSLGPHSFHJLCO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|