C20H25N3O3 — CID 98138035
(1S,6S)-N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 98138035) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (1S,6S)-N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S)-N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 98138035 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (1S,6S)-N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | CC1(C)NC(=O)N(Cc2ccc(NC(=O)C3[C@H]4CCCC[C@H]34)cc2)C1=O |
| InChI | InChI=1S/C20H25N3O3/c1-20(2)18(25)23(19(26)22-20)11-12-7-9-13(10-8-12)21-17(24)16-14-5-3-4-6-15(14)16/h7-10,14-16H,3-6,11H2,1-2H3,(H,21,24)(H,22,26)/t14-,15-/m0/s1 |
| InChIKey | PGDYTSOAAFZDLC-GJZGRUSLSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|