C22H29N3O3 — CID 46955875
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]propanamide (PubChem CID 46955875) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]propanamide.
| Compound Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]propanamide |
|---|---|
| PubChem CID | 46955875 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]propanamide |
| SMILES | CC1(C)NC(=O)N(CCC(=O)N[C@H]2C3CCCCC3[C@@H]2c2ccccc2)C1=O |
| InChI | InChI=1S/C22H29N3O3/c1-22(2)20(27)25(21(28)24-22)13-12-17(26)23-19-16-11-7-6-10-15(16)18(19)14-8-4-3-5-9-14/h3-5,8-9,15-16,18-19H,6-7,10-13H2,1-2H3,(H,23,26)(H,24,28)/t15?,16?,18-,19-/m0/s1 |
| InChIKey | MYYWTTIFBZWPCK-VHZYLWGESA-N |
| XLogP | 2.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|