C14H23N3O3 — CID 114549974
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylcyclopentyl)propanamide (PubChem CID 114549974) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylcyclopentyl)propanamide.
| Compound Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylcyclopentyl)propanamide |
|---|---|
| PubChem CID | 114549974 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(3-methylcyclopentyl)propanamide |
| SMILES | CC1CCC(NC(=O)CCN2C(=O)NC(C)(C)C2=O)C1 |
| InChI | InChI=1S/C14H23N3O3/c1-9-4-5-10(8-9)15-11(18)6-7-17-12(19)14(2,3)16-13(17)20/h9-10H,4-8H2,1-3H3,(H,15,18)(H,16,20) |
| InChIKey | TXOQCOJZFISAKF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|