C22H29N3O — CID 126417205
N-[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide (PubChem CID 126417205) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide.
| Compound Name | N-[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 126417205 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
| SMILES | Cc1nn(CCC(=O)N[C@@H]2[C@@H]3CCC[C@H]3[C@@H]2c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C22H29N3O/c1-14-15(2)24-25(16(14)3)13-12-20(26)23-22-19-11-7-10-18(19)21(22)17-8-5-4-6-9-17/h4-6,8-9,18-19,21-22H,7,10-13H2,1-3H3,(H,23,26)/t18-,19-,21+,22-/m1/s1 |
| InChIKey | UNYRHBODQVLFGT-KRXUUXHPSA-N |
| XLogP | 3.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |