C20H31N3O2 — CID 133267455
N-[(1R,5R,6S,7S)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide (PubChem CID 133267455) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(1R,5R,6S,7S)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide.
| Compound Name | N-[(1R,5R,6S,7S)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 133267455 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[(1R,5R,6S,7S)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
| SMILES | Cc1nn(CCC(=O)N[C@H]2[C@H]3CCO[C@H]3[C@H]2C2CCCC2)c(C)c1C |
| InChI | InChI=1S/C20H31N3O2/c1-12-13(2)22-23(14(12)3)10-8-17(24)21-19-16-9-11-25-20(16)18(19)15-6-4-5-7-15/h15-16,18-20H,4-11H2,1-3H3,(H,21,24)/t16-,18+,19+,20-/m1/s1 |
| InChIKey | UZQNJMDVJNUYLM-BTHPGYMESA-N |
| XLogP | 2.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |