C25H35N3O3 — CID 92596472
N-[(1S,6R,7S,8R)-8-(3,4-dimethoxyphenyl)-7-bicyclo[4.2.0]octanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide (PubChem CID 92596472) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is N-[(1S,6R,7S,8R)-8-(3,4-dimethoxyphenyl)-7-bicyclo[4.2.0]octanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide.
| Compound Name | N-[(1S,6R,7S,8R)-8-(3,4-dimethoxyphenyl)-7-bicyclo[4.2.0]octanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 92596472 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-[(1S,6R,7S,8R)-8-(3,4-dimethoxyphenyl)-7-bicyclo[4.2.0]octanyl]-3-(3,4,5-trimethylpyrazol-1-yl)propanamide |
| SMILES | COc1ccc([C@H]2[C@H]3CCCC[C@H]3[C@@H]2NC(=O)CCn2nc(C)c(C)c2C)cc1OC |
| InChI | InChI=1S/C25H35N3O3/c1-15-16(2)27-28(17(15)3)13-12-23(29)26-25-20-9-7-6-8-19(20)24(25)18-10-11-21(30-4)22(14-18)31-5/h10-11,14,19-20,24-25H,6-9,12-13H2,1-5H3,(H,26,29)/t19-,20+,24-,25-/m0/s1 |
| InChIKey | IOYHCPVEUGXEHR-IKVMQTKTSA-N |
| XLogP | 4.30 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |