C19H27NO5 — CID 69492937
ethyl 3-[[2-(3,4-dimethoxyphenyl)cyclohexyl]amino]-3-oxopropanoate (PubChem CID 69492937) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 3-[[2-(3,4-dimethoxyphenyl)cyclohexyl]amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[[2-(3,4-dimethoxyphenyl)cyclohexyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69492937 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | ethyl 3-[[2-(3,4-dimethoxyphenyl)cyclohexyl]amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NC1CCCCC1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H27NO5/c1-4-25-19(22)12-18(21)20-15-8-6-5-7-14(15)13-9-10-16(23-2)17(11-13)24-3/h9-11,14-15H,4-8,12H2,1-3H3,(H,20,21) |
| InChIKey | ITIJLHUNCDQFCJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|