C25H33NO6 — CID 18406774
N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-methoxy-3-(2-methoxyethoxy)benzamide (PubChem CID 18406774) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-methoxy-3-(2-methoxyethoxy)benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-methoxy-3-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 18406774 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-methoxy-3-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1cc(C(=O)NC2CCCCC2c2ccc(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C25H33NO6/c1-28-13-14-32-24-16-18(10-12-22(24)30-3)25(27)26-20-8-6-5-7-19(20)17-9-11-21(29-2)23(15-17)31-4/h9-12,15-16,19-20H,5-8,13-14H2,1-4H3,(H,26,27) |
| InChIKey | RYUALQYTTNWKGE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|