C22H25N3O3 — CID 70099471
N-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-3H-benzimidazole-5-carboxamide (PubChem CID 70099471) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70099471 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc([C@H]2CCCC[C@H]2NC(=O)c2ccc3nc[nH]c3c2)cc1OC |
| InChI | InChI=1S/C22H25N3O3/c1-27-20-10-8-14(12-21(20)28-2)16-5-3-4-6-17(16)25-22(26)15-7-9-18-19(11-15)24-13-23-18/h7-13,16-17H,3-6H2,1-2H3,(H,23,24)(H,25,26)/t16-,17-/m1/s1 |
| InChIKey | HNADSPZXNMFSDC-IAGOWNOFSA-N |
| XLogP | 4.04 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |