C28H28N2O6 — CID 18406743
N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-(4-nitrobenzoyl)benzamide (PubChem CID 18406743) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-(4-nitrobenzoyl)benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-(4-nitrobenzoyl)benzamide |
|---|---|
| PubChem CID | 18406743 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)cyclohexyl]-4-(4-nitrobenzoyl)benzamide |
| SMILES | COc1ccc(C2CCCCC2NC(=O)c2ccc(C(=O)c3ccc([N+](=O)[O-])cc3)cc2)cc1OC |
| InChI | InChI=1S/C28H28N2O6/c1-35-25-16-13-21(17-26(25)36-2)23-5-3-4-6-24(23)29-28(32)20-9-7-18(8-10-20)27(31)19-11-14-22(15-12-19)30(33)34/h7-17,23-24H,3-6H2,1-2H3,(H,29,32) |
| InChIKey | KYAYIRNKKHGQSR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|