C16H25N3O3 — CID 163333315
[(3S,4R)-3-(3-ethoxy-4-methoxyphenyl)-1-methylpiperidin-4-yl]urea (PubChem CID 163333315) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is [(3S,4R)-3-(3-ethoxy-4-methoxyphenyl)-1-methylpiperidin-4-yl]urea.
| Compound Name | [(3S,4R)-3-(3-ethoxy-4-methoxyphenyl)-1-methylpiperidin-4-yl]urea |
|---|---|
| PubChem CID | 163333315 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | [(3S,4R)-3-(3-ethoxy-4-methoxyphenyl)-1-methylpiperidin-4-yl]urea |
| SMILES | CCOc1cc([C@H]2CN(C)CC[C@H]2NC(N)=O)ccc1OC |
| InChI | InChI=1S/C16H25N3O3/c1-4-22-15-9-11(5-6-14(15)21-3)12-10-19(2)8-7-13(12)18-16(17)20/h5-6,9,12-13H,4,7-8,10H2,1-3H3,(H3,17,18,20)/t12-,13-/m1/s1 |
| InChIKey | CFSDMGIEYRQNLU-CHWSQXEVSA-N |
| XLogP | 1.55 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |