C19H24O4 — CID 147114747
cyclopropylmethyl 2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]cyclopropane-1-carboxylate (PubChem CID 147114747) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is cyclopropylmethyl 2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]cyclopropane-1-carboxylate.
| Compound Name | cyclopropylmethyl 2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 147114747 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | cyclopropylmethyl 2-[3-(cyclopropylmethoxy)-4-methoxyphenyl]cyclopropane-1-carboxylate |
| SMILES | COc1ccc(C2CC2C(=O)OCC2CC2)cc1OCC1CC1 |
| InChI | InChI=1S/C19H24O4/c1-21-17-7-6-14(8-18(17)22-10-12-2-3-12)15-9-16(15)19(20)23-11-13-4-5-13/h6-8,12-13,15-16H,2-5,9-11H2,1H3 |
| InChIKey | BNETVPCXYPZHQU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |