C20H25NO5 — CID 19038585
2-cyano-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-1-methoxycyclohexane-1-carboxylic acid (PubChem CID 19038585) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-cyano-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-1-methoxycyclohexane-1-carboxylic acid.
| Compound Name | 2-cyano-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-1-methoxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19038585 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-cyano-4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-1-methoxycyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(C2CCC(OC)(C(=O)O)C(C#N)C2)cc1OCC1CC1 |
| InChI | InChI=1S/C20H25NO5/c1-24-17-6-5-14(10-18(17)26-12-13-3-4-13)15-7-8-20(25-2,19(22)23)16(9-15)11-21/h5-6,10,13,15-16H,3-4,7-9,12H2,1-2H3,(H,22,23) |
| InChIKey | LMORWUNGWGLUCU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |