C19H22N4O3 — CID 126417165
4-methyl-N-[2-oxo-2-[[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]amino]ethyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 126417165) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-methyl-N-[2-oxo-2-[[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]amino]ethyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-methyl-N-[2-oxo-2-[[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]amino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 126417165 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-methyl-N-[2-oxo-2-[[(1R,5R,6R,7R)-7-phenyl-6-bicyclo[3.2.0]heptanyl]amino]ethyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Cc1nonc1C(=O)NCC(=O)N[C@@H]1[C@@H]2CCC[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H22N4O3/c1-11-17(23-26-22-11)19(25)20-10-15(24)21-18-14-9-5-8-13(14)16(18)12-6-3-2-4-7-12/h2-4,6-7,13-14,16,18H,5,8-10H2,1H3,(H,20,25)(H,21,24)/t13-,14-,16+,18-/m1/s1 |
| InChIKey | MHUKQJPRJAZPOK-AHEZYBDSSA-N |
| XLogP | 1.81 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |