C20H24N2OS — CID 92597793
2,4-dimethyl-N-[(1S,6S,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1,3-thiazole-5-carboxamide (PubChem CID 92597793) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(1S,6S,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[(1S,6S,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 92597793 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2,4-dimethyl-N-[(1S,6S,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)N[C@H]2[C@H]3CCCC[C@@H]3[C@@H]2c2ccccc2)s1 |
| InChI | InChI=1S/C20H24N2OS/c1-12-19(24-13(2)21-12)20(23)22-18-16-11-7-6-10-15(16)17(18)14-8-4-3-5-9-14/h3-5,8-9,15-18H,6-7,10-11H2,1-2H3,(H,22,23)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | VLLZCVFWLVLISA-XSLAGTTESA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |