C22H31NO3 — CID 46955879
2-(oxan-2-ylmethoxy)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide (PubChem CID 46955879) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 2-(oxan-2-ylmethoxy)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide.
| Compound Name | 2-(oxan-2-ylmethoxy)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide |
|---|---|
| PubChem CID | 46955879 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 2-(oxan-2-ylmethoxy)-N-[(7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide |
| SMILES | O=C(COCC1CCCCO1)N[C@H]1C2CCCCC2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H31NO3/c24-20(15-25-14-17-10-6-7-13-26-17)23-22-19-12-5-4-11-18(19)21(22)16-8-2-1-3-9-16/h1-3,8-9,17-19,21-22H,4-7,10-15H2,(H,23,24)/t17?,18?,19?,21-,22-/m0/s1 |
| InChIKey | LKBLVJDAOFNYSY-QGSFHLTQSA-N |
| XLogP | 3.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |