C18H24N2O3S — CID 124758955
N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[(2S)-oxan-2-yl]methoxy]acetamide (PubChem CID 124758955) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[(2S)-oxan-2-yl]methoxy]acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[(2S)-oxan-2-yl]methoxy]acetamide |
|---|---|
| PubChem CID | 124758955 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-[[(2S)-oxan-2-yl]methoxy]acetamide |
| SMILES | O=C(COC[C@@H]1CCCCO1)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H24N2O3S/c21-17(13-22-12-14-6-3-4-11-23-14)19-10-5-9-18-20-15-7-1-2-8-16(15)24-18/h1-2,7-8,14H,3-6,9-13H2,(H,19,21)/t14-/m0/s1 |
| InChIKey | ZXTYGLZLGGITDF-AWEZNQCLSA-N |
| XLogP | 2.93 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|