C16H20N2O2S — CID 71983741
N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(oxan-4-yl)acetamide (PubChem CID 71983741) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(oxan-4-yl)acetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 71983741 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-2-(oxan-4-yl)acetamide |
| SMILES | O=C(CC1CCOCC1)NCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H20N2O2S/c19-15(11-12-6-9-20-10-7-12)17-8-5-16-18-13-3-1-2-4-14(13)21-16/h1-4,12H,5-11H2,(H,17,19) |
| InChIKey | HXBHLURFNTTXNN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |