C13H16N2S — CID 43654900
2-(1,3-benzothiazol-2-yl)-N-(cyclopropylmethyl)ethanamine (PubChem CID 43654900) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N-(cyclopropylmethyl)ethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N-(cyclopropylmethyl)ethanamine |
|---|---|
| PubChem CID | 43654900 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N-(cyclopropylmethyl)ethanamine |
| SMILES | c1ccc2sc(CCNCC3CC3)nc2c1 |
| InChI | InChI=1S/C13H16N2S/c1-2-4-12-11(3-1)15-13(16-12)7-8-14-9-10-5-6-10/h1-4,10,14H,5-9H2 |
| InChIKey | KRSFAVFPLRYLJV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|