C14H18N2S2 — CID 43394930
N-[2-(1,3-benzothiazol-2-yl)ethyl]thian-4-amine (PubChem CID 43394930) has the molecular formula C14H18N2S2 and a molecular weight of 278.45 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]thian-4-amine.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]thian-4-amine |
|---|---|
| PubChem CID | 43394930 |
| Molecular Formula | C14H18N2S2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]thian-4-amine |
| SMILES | c1ccc2sc(CCNC3CCSCC3)nc2c1 |
| InChI | InChI=1S/C14H18N2S2/c1-2-4-13-12(3-1)16-14(18-13)5-8-15-11-6-9-17-10-7-11/h1-4,11,15H,5-10H2 |
| InChIKey | WMUKTJHJCPFQRQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |