C18H21N3O3 — CID 126417233
2-(2,4-dioxoimidazolidin-1-yl)-N-[(1R,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]acetamide (PubChem CID 126417233) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-(2,4-dioxoimidazolidin-1-yl)-N-[(1R,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]acetamide.
| Compound Name | 2-(2,4-dioxoimidazolidin-1-yl)-N-[(1R,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]acetamide |
|---|---|
| PubChem CID | 126417233 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-(2,4-dioxoimidazolidin-1-yl)-N-[(1R,5R,6R,7S)-7-phenyl-6-bicyclo[3.2.0]heptanyl]acetamide |
| SMILES | O=C1CN(CC(=O)N[C@@H]2[C@@H]3CCC[C@H]3[C@H]2c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C18H21N3O3/c22-14(9-21-10-15(23)20-18(21)24)19-17-13-8-4-7-12(13)16(17)11-5-2-1-3-6-11/h1-3,5-6,12-13,16-17H,4,7-10H2,(H,19,22)(H,20,23,24)/t12-,13-,16-,17-/m1/s1 |
| InChIKey | ZXYWHPWJNFPNIM-BQGCOEIASA-N |
| XLogP | 1.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|