C22H29N3O3 — CID 125037369
2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[(1R,6R,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide (PubChem CID 125037369) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[(1R,6R,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[(1R,6R,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide |
|---|---|
| PubChem CID | 125037369 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[(1R,6R,7S,8R)-8-phenyl-7-bicyclo[4.2.0]octanyl]acetamide |
| SMILES | CCCN1C(=O)N[C@H](CC(=O)N[C@H]2[C@@H]3CCCC[C@H]3[C@@H]2c2ccccc2)C1=O |
| InChI | InChI=1S/C22H29N3O3/c1-2-12-25-21(27)17(23-22(25)28)13-18(26)24-20-16-11-7-6-10-15(16)19(20)14-8-4-3-5-9-14/h3-5,8-9,15-17,19-20H,2,6-7,10-13H2,1H3,(H,23,28)(H,24,26)/t15-,16-,17-,19+,20+/m1/s1 |
| InChIKey | NYDTXPKRSIXSCG-QKMNUUQDSA-N |
| XLogP | 2.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|