C22H28N2O2 — CID 92548302
(3R)-5-oxo-N-[(1S,6S,7R,8S)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 92548302) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (3R)-5-oxo-N-[(1S,6S,7R,8S)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-5-oxo-N-[(1S,6S,7R,8S)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 92548302 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (3R)-5-oxo-N-[(1S,6S,7R,8S)-8-phenyl-7-bicyclo[4.2.0]octanyl]-1-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCN1C[C@H](C(=O)N[C@@H]2[C@H]3CCCC[C@@H]3[C@H]2c2ccccc2)CC1=O |
| InChI | InChI=1S/C22H28N2O2/c1-2-12-24-14-16(13-19(24)25)22(26)23-21-18-11-7-6-10-17(18)20(21)15-8-4-3-5-9-15/h2-5,8-9,16-18,20-21H,1,6-7,10-14H2,(H,23,26)/t16-,17+,18+,20-,21-/m1/s1 |
| InChIKey | ZPXCRBBIHGGEAR-MGSPEMMDSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|