C16H25N3O6 — CID 154912573
formic acid;2-[4-[(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)amino]piperidin-1-yl]acetic acid (PubChem CID 154912573) has the molecular formula C16H25N3O6 and a molecular weight of 355.39 g/mol. Its IUPAC name is formic acid;2-[4-[(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)amino]piperidin-1-yl]acetic acid.
| Compound Name | formic acid;2-[4-[(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)amino]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 154912573 |
| Molecular Formula | C16H25N3O6 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | formic acid;2-[4-[(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)amino]piperidin-1-yl]acetic acid |
| SMILES | C=CCN1CC(C(=O)NC2CCN(CC(=O)O)CC2)CC1=O.O=CO |
| InChI | InChI=1S/C15H23N3O4.CH2O2/c1-2-5-18-9-11(8-13(18)19)15(22)16-12-3-6-17(7-4-12)10-14(20)21;2-1-3/h2,11-12H,1,3-10H2,(H,16,22)(H,20,21);1H,(H,2,3) |
| InChIKey | CREQNVWEPBJQIZ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|