C8H10ClNO2 — CID 94075728
(3R)-5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl chloride (PubChem CID 94075728) has the molecular formula C8H10ClNO2 and a molecular weight of 187.63 g/mol. Its IUPAC name is (3R)-5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl chloride.
| Compound Name | (3R)-5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 94075728 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (3R)-5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl chloride |
| SMILES | C=CCN1C[C@H](C(=O)Cl)CC1=O |
| InChI | InChI=1S/C8H10ClNO2/c1-2-3-10-5-6(8(9)12)4-7(10)11/h2,6H,1,3-5H2/t6-/m1/s1 |
| InChIKey | NTEPPPHMJKGEPY-ZCFIWIBFSA-N |
| XLogP | 0.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|