C14H19N3O3 — CID 134708371
N-(3-ethyl-4-methyl-1,2-oxazol-5-yl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide (PubChem CID 134708371) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-(3-ethyl-4-methyl-1,2-oxazol-5-yl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide.
| Compound Name | N-(3-ethyl-4-methyl-1,2-oxazol-5-yl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134708371 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-(3-ethyl-4-methyl-1,2-oxazol-5-yl)-5-oxo-1-prop-2-enylpyrrolidine-3-carboxamide |
| SMILES | C=CCN1CC(C(=O)Nc2onc(CC)c2C)CC1=O |
| InChI | InChI=1S/C14H19N3O3/c1-4-6-17-8-10(7-12(17)18)13(19)15-14-9(3)11(5-2)16-20-14/h4,10H,1,5-8H2,2-3H3,(H,15,19) |
| InChIKey | XZAJBZLTKJDNEO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|