C18H18N4O4 — CID 46969235
N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 46969235) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46969235 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CC1(C)NC(=O)N(Cc2ccc(NC(=O)c3cc[nH]c(=O)c3)cc2)C1=O |
| InChI | InChI=1S/C18H18N4O4/c1-18(2)16(25)22(17(26)21-18)10-11-3-5-13(6-4-11)20-15(24)12-7-8-19-14(23)9-12/h3-9H,10H2,1-2H3,(H,19,23)(H,20,24)(H,21,26) |
| InChIKey | WIYXFOOWHPFCFD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|