C21H22N4O5 — CID 7182046
4-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(4-methoxyphenyl)benzamide (PubChem CID 7182046) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 4-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 7182046 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)CN3C(=O)NC(C)(C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C21H22N4O5/c1-21(2)19(28)25(20(29)24-21)12-17(26)22-14-6-4-13(5-7-14)18(27)23-15-8-10-16(30-3)11-9-15/h4-11H,12H2,1-3H3,(H,22,26)(H,23,27)(H,24,29) |
| InChIKey | KEJVTCOVIQAUCH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|