C20H21N3O4 — CID 7182004
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide (PubChem CID 7182004) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7182004 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(4-phenylmethoxyphenyl)acetamide |
| SMILES | CC1(C)NC(=O)N(CC(=O)Nc2ccc(OCc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C20H21N3O4/c1-20(2)18(25)23(19(26)22-20)12-17(24)21-15-8-10-16(11-9-15)27-13-14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3,(H,21,24)(H,22,26) |
| InChIKey | QFVYFHMYIWWLFK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|