C24H27N3O4 — CID 4857041
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(4-phenylmethoxyphenyl)acetamide (PubChem CID 4857041) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4857041 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(4-phenylmethoxyphenyl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCCC2)C1=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N3O4/c28-21(16-27-22(29)24(26-23(27)30)14-6-1-2-7-15-24)25-19-10-12-20(13-11-19)31-17-18-8-4-3-5-9-18/h3-5,8-13H,1-2,6-7,14-17H2,(H,25,28)(H,26,30) |
| InChIKey | JQANQSKQBMHOQK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|