C13H14INO — CID 79600560
N-(4-iodophenyl)bicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 79600560) has the molecular formula C13H14INO and a molecular weight of 327.17 g/mol. Its IUPAC name is N-(4-iodophenyl)bicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | N-(4-iodophenyl)bicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 79600560 |
| Molecular Formula | C13H14INO |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | N-(4-iodophenyl)bicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)C1C2CCCC21 |
| InChI | InChI=1S/C13H14INO/c14-8-4-6-9(7-5-8)15-13(16)12-10-2-1-3-11(10)12/h4-7,10-12H,1-3H2,(H,15,16) |
| InChIKey | HYCOBSFHLKUOTC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|