C17H21IN2O2 — CID 67996336
(1R,2S,3R,4S)-3-N-(4-iodophenyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 67996336) has the molecular formula C17H21IN2O2 and a molecular weight of 412.27 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-N-(4-iodophenyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | (1R,2S,3R,4S)-3-N-(4-iodophenyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67996336 |
| Molecular Formula | C17H21IN2O2 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | (1R,2S,3R,4S)-3-N-(4-iodophenyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | CC1(C)[C@@H]2CC[C@H]1[C@@H](C(=O)Nc1ccc(I)cc1)[C@H]2C(N)=O |
| InChI | InChI=1S/C17H21IN2O2/c1-17(2)11-7-8-12(17)14(13(11)15(19)21)16(22)20-10-5-3-9(18)4-6-10/h3-6,11-14H,7-8H2,1-2H3,(H2,19,21)(H,20,22)/t11-,12+,13+,14-/m1/s1 |
| InChIKey | POZYTCMOBXAZIW-ZOBORPQBSA-N |
| XLogP | 3.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|