C18H23BrN2O2 — CID 123784150
3-N-(4-bromophenyl)-1-tert-butylbicyclo[2.2.0]hexane-2,3-dicarboxamide (PubChem CID 123784150) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 3-N-(4-bromophenyl)-1-tert-butylbicyclo[2.2.0]hexane-2,3-dicarboxamide.
| Compound Name | 3-N-(4-bromophenyl)-1-tert-butylbicyclo[2.2.0]hexane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 123784150 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-N-(4-bromophenyl)-1-tert-butylbicyclo[2.2.0]hexane-2,3-dicarboxamide |
| SMILES | CC(C)(C)C12CCC1C(C(=O)Nc1ccc(Br)cc1)C2C(N)=O |
| InChI | InChI=1S/C18H23BrN2O2/c1-17(2,3)18-9-8-12(18)13(14(18)15(20)22)16(23)21-11-6-4-10(19)5-7-11/h4-7,12-14H,8-9H2,1-3H3,(H2,20,22)(H,21,23) |
| InChIKey | VZUCIUCMWYRUGY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |