C18H22N2O2S — CID 67995859
(1R,2S,3R,4S)-3-N-(4-methylsulfanylphenyl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67995859) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-N-(4-methylsulfanylphenyl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2S,3R,4S)-3-N-(4-methylsulfanylphenyl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67995859 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (1R,2S,3R,4S)-3-N-(4-methylsulfanylphenyl)spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CSc1ccc(NC(=O)[C@H]2[C@@H](C(N)=O)[C@H]3CC[C@@H]2C32CC2)cc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-23-11-4-2-10(3-5-11)20-17(22)15-13-7-6-12(14(15)16(19)21)18(13)8-9-18/h2-5,12-15H,6-9H2,1H3,(H2,19,21)(H,20,22)/t12-,13+,14+,15-/m1/s1 |
| InChIKey | UDOURHNYCLALKF-CBBWQLFWSA-N |
| XLogP | 2.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |