C18H23BrN2O2 — CID 130293886
6-N-(4-bromophenyl)-7-ethyl-4-methylspiro[2.4]heptane-5,6-dicarboxamide (PubChem CID 130293886) has the molecular formula C18H23BrN2O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is 6-N-(4-bromophenyl)-7-ethyl-4-methylspiro[2.4]heptane-5,6-dicarboxamide.
| Compound Name | 6-N-(4-bromophenyl)-7-ethyl-4-methylspiro[2.4]heptane-5,6-dicarboxamide |
|---|---|
| PubChem CID | 130293886 |
| Molecular Formula | C18H23BrN2O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 6-N-(4-bromophenyl)-7-ethyl-4-methylspiro[2.4]heptane-5,6-dicarboxamide |
| SMILES | CCC1C(C(=O)Nc2ccc(Br)cc2)C(C(N)=O)C(C)C12CC2 |
| InChI | InChI=1S/C18H23BrN2O2/c1-3-13-15(14(16(20)22)10(2)18(13)8-9-18)17(23)21-12-6-4-11(19)5-7-12/h4-7,10,13-15H,3,8-9H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | OGJDGVANYOPDTC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |