C22H26BrN3O3 — CID 67495181
(1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[3-(dimethylamino)-3-oxopropyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67495181) has the molecular formula C22H26BrN3O3 and a molecular weight of 460.37 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[3-(dimethylamino)-3-oxopropyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[3-(dimethylamino)-3-oxopropyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67495181 |
| Molecular Formula | C22H26BrN3O3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-[3-(dimethylamino)-3-oxopropyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | CN(C)C(=O)CCNC(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C22H26BrN3O3/c1-26(2)17(27)9-12-24-20(28)18-15-7-8-16(22(15)10-11-22)19(18)21(29)25-14-5-3-13(23)4-6-14/h3-8,15-16,18-19H,9-12H2,1-2H3,(H,24,28)(H,25,29)/t15-,16+,18-,19-/m1/s1 |
| InChIKey | HJIHAIULVASTFD-UKBAYJJMSA-N |
| XLogP | 2.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|