C29H32BrN3O3 — CID 67496609
(1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(2-morpholin-4-yl-2-phenylethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 67496609) has the molecular formula C29H32BrN3O3 and a molecular weight of 550.50 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(2-morpholin-4-yl-2-phenylethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(2-morpholin-4-yl-2-phenylethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67496609 |
| Molecular Formula | C29H32BrN3O3 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(4-bromophenyl)-2-N-(2-morpholin-4-yl-2-phenylethyl)spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | O=C(NCC(c1ccccc1)N1CCOCC1)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C29H32BrN3O3/c30-20-6-8-21(9-7-20)32-28(35)26-23-11-10-22(29(23)12-13-29)25(26)27(34)31-18-24(19-4-2-1-3-5-19)33-14-16-36-17-15-33/h1-11,22-26H,12-18H2,(H,31,34)(H,32,35)/t22-,23+,24?,25-,26-/m1/s1 |
| InChIKey | MNUMGQYFYORVLC-UXYYBULGSA-N |
| XLogP | 4.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|