C20H23BrN2O2 — CID 30834490
4-bromo-N-[(2S)-2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 30834490) has the molecular formula C20H23BrN2O2 and a molecular weight of 403.32 g/mol. Its IUPAC name is 4-bromo-N-[(2S)-2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 4-bromo-N-[(2S)-2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 30834490 |
| Molecular Formula | C20H23BrN2O2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 4-bromo-N-[(2S)-2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | Cc1ccc([C@@H](CNC(=O)c2ccc(Br)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23BrN2O2/c1-15-2-4-16(5-3-15)19(23-10-12-25-13-11-23)14-22-20(24)17-6-8-18(21)9-7-17/h2-9,19H,10-14H2,1H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | NUVWSTFTUGWJGS-LJQANCHMSA-N |
| XLogP | 3.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |