C20H27Cl2N3O2 — CID 119946754
2-amino-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide;dihydrochloride (PubChem CID 119946754) has the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-amino-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946754 |
| Molecular Formula | C20H27Cl2N3O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-amino-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide;dihydrochloride |
| SMILES | Cc1ccc(C(CNC(=O)c2ccccc2N)N2CCOCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H25N3O2.2ClH/c1-15-6-8-16(9-7-15)19(23-10-12-25-13-11-23)14-22-20(24)17-4-2-3-5-18(17)21;;/h2-9,19H,10-14,21H2,1H3,(H,22,24);2*1H |
| InChIKey | GGEWXACJCUBVRA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|