C25H32BrN3O4 — CID 67496376
tert-butyl N-[3-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propyl]carbamate (PubChem CID 67496376) has the molecular formula C25H32BrN3O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 67496376 |
| Molecular Formula | C25H32BrN3O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | tert-butyl N-[3-[[(1R,2R,3R,4S)-3-[(4-bromophenyl)carbamoyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carbonyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C25H32BrN3O4/c1-24(2,3)33-23(32)28-14-4-13-27-21(30)19-17-9-10-18(25(17)11-12-25)20(19)22(31)29-16-7-5-15(26)6-8-16/h5-10,17-20H,4,11-14H2,1-3H3,(H,27,30)(H,28,32)(H,29,31)/t17-,18+,19-,20-/m1/s1 |
| InChIKey | PHNIZRRXPZSKNO-IYWMVGAKSA-N |
| XLogP | 4.25 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|