C23H24BrN3O2S — CID 67496417
(1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide (PubChem CID 67496417) has the molecular formula C23H24BrN3O2S and a molecular weight of 486.44 g/mol. Its IUPAC name is (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide.
| Compound Name | (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
|---|---|
| PubChem CID | 67496417 |
| Molecular Formula | C23H24BrN3O2S |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
| SMILES | Cc1nc(CC(=O)NC[C@H]2[C@H](C(=O)Nc3ccc(Br)cc3)[C@@H]3C=C[C@H]2C32CC2)cs1 |
| InChI | InChI=1S/C23H24BrN3O2S/c1-13-26-16(12-30-13)10-20(28)25-11-17-18-6-7-19(23(18)8-9-23)21(17)22(29)27-15-4-2-14(24)3-5-15/h2-7,12,17-19,21H,8-11H2,1H3,(H,25,28)(H,27,29)/t17-,18-,19+,21+/m1/s1 |
| InChIKey | GMDRVBFTYMHGAI-BNDYYXHWSA-N |
| XLogP | 4.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|